C15H23NO2 — CID 71693830
(1R,2S,3R,4R)-3-(2-methylpropylamino)-4-phenylcyclopentane-1,2-diol (PubChem CID 71693830) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-(2-methylpropylamino)-4-phenylcyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,4R)-3-(2-methylpropylamino)-4-phenylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 71693830 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (1R,2S,3R,4R)-3-(2-methylpropylamino)-4-phenylcyclopentane-1,2-diol |
| SMILES | CC(C)CN[C@H]1[C@H](O)[C@H](O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H23NO2/c1-10(2)9-16-14-12(8-13(17)15(14)18)11-6-4-3-5-7-11/h3-7,10,12-18H,8-9H2,1-2H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | ZCRLYGGQCYNLKZ-KBUPBQIOSA-N |
| XLogP | 1.51 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |