C19H23NO2 — CID 71693864
(1R,2S,3R,4R)-3-(benzylamino)-4-(4-methylphenyl)cyclopentane-1,2-diol (PubChem CID 71693864) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-(benzylamino)-4-(4-methylphenyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,4R)-3-(benzylamino)-4-(4-methylphenyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 71693864 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (1R,2S,3R,4R)-3-(benzylamino)-4-(4-methylphenyl)cyclopentane-1,2-diol |
| SMILES | Cc1ccc([C@H]2C[C@@H](O)[C@@H](O)[C@@H]2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-13-7-9-15(10-8-13)16-11-17(21)19(22)18(16)20-12-14-5-3-2-4-6-14/h2-10,16-22H,11-12H2,1H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | GSIIJLXFIZJLKM-NCXUSEDFSA-N |
| XLogP | 2.36 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |