C17H25NO2 — CID 71693875
(1R,2S,3R,4R)-4-(4-methylphenyl)-3-piperidin-1-ylcyclopentane-1,2-diol (PubChem CID 71693875) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (1R,2S,3R,4R)-4-(4-methylphenyl)-3-piperidin-1-ylcyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,4R)-4-(4-methylphenyl)-3-piperidin-1-ylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 71693875 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (1R,2S,3R,4R)-4-(4-methylphenyl)-3-piperidin-1-ylcyclopentane-1,2-diol |
| SMILES | Cc1ccc([C@H]2C[C@@H](O)[C@@H](O)[C@@H]2N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H25NO2/c1-12-5-7-13(8-6-12)14-11-15(19)17(20)16(14)18-9-3-2-4-10-18/h5-8,14-17,19-20H,2-4,9-11H2,1H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | MEGYAWWYAYFVBX-QBPKDAKJSA-N |
| XLogP | 2.06 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |