About (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine
(3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine (PubChem CID 71694160) has the molecular formula C18H22F2N4O
and a molecular weight of 348.40 g/mol. Its IUPAC name is (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine.
Molecular Properties
| Compound Name | (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine |
| PubChem CID | 71694160 |
| Molecular Formula | C18H22F2N4O |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine |
| SMILES | Fc1ccc(-c2cnc([C@@H]3COCCN3C3CCNCC3)[nH]2)c(F)c1 |
| InChI | InChI=1S/C18H22F2N4O/c19-12-1-2-14(15(20)9-12)16-10-22-18(23-16)17-11-25-8-7-24(17)13-3-5-21-6-4-13/h1-2,9-10,13,17,21H,3-8,11H2,(H,22,23)/t17-/m0/s1 |
| InChIKey | AYSSPQZLKMOQKZ-KRWDZBQOSA-N |
| XLogP | 2.48 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine?
The IUPAC name of (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine (CID 71694160) is (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine.
What is the SMILES notation for (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine?
The canonical SMILES for (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine is Fc1ccc(-c2cnc([C@@H]3COCCN3C3CCNCC3)[nH]2)c(F)c1.
What is the InChIKey of (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine?
The InChIKey is AYSSPQZLKMOQKZ-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H22F2N4O/c19-12-1-2-14(15(20)9-12)16-10-22-18(23-16)17-11-25-8-7-24(17)13-3-5-21-6-4-13/h1-2,9-10,13,17,21H,3-8,11H2,(H,22,23)/t17-/m0/s1.
What are the key properties of (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine?
(3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine has a molecular weight of 348.40 g/mol, XLogP of 2.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]-4-piperidin-4-ylmorpholine is sourced from PubChem (CID 71694160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).