About (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine
(3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine (PubChem CID 71694312) has the molecular formula C14H20N4O2S
and a molecular weight of 308.41 g/mol. Its IUPAC name is (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine.
Molecular Properties
| Compound Name | (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine |
| PubChem CID | 71694312 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine |
| SMILES | CC(C)(C)c1coc([C@@H]2COCCN2Cc2csnn2)n1 |
| InChI | InChI=1S/C14H20N4O2S/c1-14(2,3)12-8-20-13(15-12)11-7-19-5-4-18(11)6-10-9-21-17-16-10/h8-9,11H,4-7H2,1-3H3/t11-/m0/s1 |
| InChIKey | JDOXQPPWGRJLEH-NSHDSACASA-N |
| XLogP | 2.40 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine?
The IUPAC name of (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine (CID 71694312) is (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine.
What is the SMILES notation for (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine?
The canonical SMILES for (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine is CC(C)(C)c1coc([C@@H]2COCCN2Cc2csnn2)n1.
What is the InChIKey of (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine?
The InChIKey is JDOXQPPWGRJLEH-NSHDSACASA-N. The full InChI is InChI=1S/C14H20N4O2S/c1-14(2,3)12-8-20-13(15-12)11-7-19-5-4-18(11)6-10-9-21-17-16-10/h8-9,11H,4-7H2,1-3H3/t11-/m0/s1.
What are the key properties of (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine?
(3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine has a molecular weight of 308.41 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(4-tert-butyl-1,3-oxazol-2-yl)-4-(thiadiazol-4-ylmethyl)morpholine is sourced from PubChem (CID 71694312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).