C27H36O8 — CID 71694441
[13-acetyloxy-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-2-methylbut-2-enoate (PubChem CID 71694441) has the molecular formula C27H36O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is [13-acetyloxy-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-2-methylbut-2-enoate.
| Compound Name | [13-acetyloxy-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 71694441 |
| Molecular Formula | C27H36O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [13-acetyloxy-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC1C(C)C2(O)C(C=C(CO)CC3(O)C(=O)C(C)=CC32)C2C(C)(C)C12OC(C)=O |
| InChI | InChI=1S/C27H36O8/c1-8-13(2)23(31)34-22-15(4)26(33)18(20-24(6,7)27(20,22)35-16(5)29)10-17(12-28)11-25(32)19(26)9-14(3)21(25)30/h8-10,15,18-20,22,28,32-33H,11-12H2,1-7H3/b13-8+ |
| InChIKey | PCASZNXKLGTEGB-MDWZMJQESA-N |
| XLogP | 2.02 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|