C21H34O11 — CID 71694462
(1R,4R,7S,11E,15S,19R,20R,21S,22S,24R)-7,20,21,22,24-pentahydroxy-11,15-dimethyl-3,5,9,18,23-pentaoxatricyclo[17.3.1.14,7]tetracos-11-en-10-one (PubChem CID 71694462) has the molecular formula C21H34O11 and a molecular weight of 462.49 g/mol. Its IUPAC name is (1R,4R,7S,11E,15S,19R,20R,21S,22S,24R)-7,20,21,22,24-pentahydroxy-11,15-dimethyl-3,5,9,18,23-pentaoxatricyclo[17.3.1.14,7]tetracos-11-en-10-one.
| Compound Name | (1R,4R,7S,11E,15S,19R,20R,21S,22S,24R)-7,20,21,22,24-pentahydroxy-11,15-dimethyl-3,5,9,18,23-pentaoxatricyclo[17.3.1.14,7]tetracos-11-en-10-one |
|---|---|
| PubChem CID | 71694462 |
| Molecular Formula | C21H34O11 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | (1R,4R,7S,11E,15S,19R,20R,21S,22S,24R)-7,20,21,22,24-pentahydroxy-11,15-dimethyl-3,5,9,18,23-pentaoxatricyclo[17.3.1.14,7]tetracos-11-en-10-one |
| SMILES | C/C1=C\CC[C@H](C)CCO[C@@H]2O[C@H](CO[C@@H]3OC[C@](O)(COC1=O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C21H34O11/c1-11-4-3-5-12(2)18(26)30-9-21(27)10-31-20(17(21)25)29-8-13-14(22)15(23)16(24)19(32-13)28-7-6-11/h5,11,13-17,19-20,22-25,27H,3-4,6-10H2,1-2H3/b12-5+/t11-,13+,14+,15-,16+,17-,19+,20+,21+/m0/s1 |
| InChIKey | FSTIKTPQGMHLFJ-AIECACTBSA-N |
| XLogP | -1.41 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |