About (4E)-3-bromo-4-butylidene-2,6-diphenylpyran
(4E)-3-bromo-4-butylidene-2,6-diphenylpyran (PubChem CID 71694493) has the molecular formula C21H19BrO
and a molecular weight of 367.29 g/mol. Its IUPAC name is (4E)-3-bromo-4-butylidene-2,6-diphenylpyran.
Molecular Properties
| Compound Name | (4E)-3-bromo-4-butylidene-2,6-diphenylpyran |
| PubChem CID | 71694493 |
| Molecular Formula | C21H19BrO |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (4E)-3-bromo-4-butylidene-2,6-diphenylpyran |
| SMILES | CCC/C=C1\C=C(c2ccccc2)OC(c2ccccc2)=C1Br |
| InChI | InChI=1S/C21H19BrO/c1-2-3-10-18-15-19(16-11-6-4-7-12-16)23-21(20(18)22)17-13-8-5-9-14-17/h4-15H,2-3H2,1H3/b18-10+ |
| InChIKey | OUCZSEAEASNQHY-VCHYOVAHSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4E)-3-bromo-4-butylidene-2,6-diphenylpyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-3-bromo-4-butylidene-2,6-diphenylpyran?
The IUPAC name of (4E)-3-bromo-4-butylidene-2,6-diphenylpyran (CID 71694493) is (4E)-3-bromo-4-butylidene-2,6-diphenylpyran.
What is the SMILES notation for (4E)-3-bromo-4-butylidene-2,6-diphenylpyran?
The canonical SMILES for (4E)-3-bromo-4-butylidene-2,6-diphenylpyran is CCC/C=C1\C=C(c2ccccc2)OC(c2ccccc2)=C1Br.
What is the InChIKey of (4E)-3-bromo-4-butylidene-2,6-diphenylpyran?
The InChIKey is OUCZSEAEASNQHY-VCHYOVAHSA-N. The full InChI is InChI=1S/C21H19BrO/c1-2-3-10-18-15-19(16-11-6-4-7-12-16)23-21(20(18)22)17-13-8-5-9-14-17/h4-15H,2-3H2,1H3/b18-10+.
What are the key properties of (4E)-3-bromo-4-butylidene-2,6-diphenylpyran?
(4E)-3-bromo-4-butylidene-2,6-diphenylpyran has a molecular weight of 367.29 g/mol, XLogP of 6.55, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-3-bromo-4-butylidene-2,6-diphenylpyran is sourced from PubChem (CID 71694493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).