About 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine
3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine (PubChem CID 71695174) has the molecular formula C15H12F3N3O2S
and a molecular weight of 355.34 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine |
| PubChem CID | 71695174 |
| Molecular Formula | C15H12F3N3O2S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C(F)(F)F)n2nc(C)c(S(=O)(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C15H12F3N3O2S/c1-9-8-12(15(16,17)18)21-14(19-9)13(10(2)20-21)24(22,23)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | WTMHVXAXXNBOPU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine?
The IUPAC name of 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine (CID 71695174) is 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine is Cc1cc(C(F)(F)F)n2nc(C)c(S(=O)(=O)c3ccccc3)c2n1.
What is the InChIKey of 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine?
The InChIKey is WTMHVXAXXNBOPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F3N3O2S/c1-9-8-12(15(16,17)18)21-14(19-9)13(10(2)20-21)24(22,23)11-6-4-3-5-7-11/h3-8H,1-2H3.
What are the key properties of 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine?
3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine has a molecular weight of 355.34 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-2,5-dimethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 71695174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).