About 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone
1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone (PubChem CID 71695286) has the molecular formula C8H4ClF3O2
and a molecular weight of 224.56 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone |
| PubChem CID | 71695286 |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.56 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cc(Cl)ccc1O)C(F)(F)F |
| InChI | InChI=1S/C8H4ClF3O2/c9-4-1-2-6(13)5(3-4)7(14)8(10,11)12/h1-3,13H |
| InChIKey | ZIEZOWUWNOVSDH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone (CID 71695286) is 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone is O=C(c1cc(Cl)ccc1O)C(F)(F)F.
What is the InChIKey of 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone?
The InChIKey is ZIEZOWUWNOVSDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClF3O2/c9-4-1-2-6(13)5(3-4)7(14)8(10,11)12/h1-3,13H.
What are the key properties of 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone?
1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone has a molecular weight of 224.56 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 71695286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).