C10H10FNO2 — CID 71695410
6-fluoro-1,2,3,4-tetrahydroquinoline-3-carboxylic acid (PubChem CID 71695410) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 6-fluoro-1,2,3,4-tetrahydroquinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-1,2,3,4-tetrahydroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71695410 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 6-fluoro-1,2,3,4-tetrahydroquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1CNc2ccc(F)cc2C1 |
| InChI | InChI=1S/C10H10FNO2/c11-8-1-2-9-6(4-8)3-7(5-12-9)10(13)14/h1-2,4,7,12H,3,5H2,(H,13,14) |
| InChIKey | ZTBRMAQMEWGQHX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |