About 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine
3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine (PubChem CID 71695418) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine |
| PubChem CID | 71695418 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine |
| SMILES | Cc1n[nH]c(C)c1C1COCCN1 |
| InChI | InChI=1S/C9H15N3O/c1-6-9(7(2)12-11-6)8-5-13-4-3-10-8/h8,10H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | OOFRPEDNTOJVQY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine?
The IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine (CID 71695418) is 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine.
What is the SMILES notation for 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine?
The canonical SMILES for 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine is Cc1n[nH]c(C)c1C1COCCN1.
What is the InChIKey of 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine?
The InChIKey is OOFRPEDNTOJVQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-6-9(7(2)12-11-6)8-5-13-4-3-10-8/h8,10H,3-5H2,1-2H3,(H,11,12).
What are the key properties of 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine?
3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine has a molecular weight of 181.24 g/mol, XLogP of 0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1H-pyrazol-4-yl)morpholine is sourced from PubChem (CID 71695418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).