About 4-cyclopropyl-1,3-thiazole-5-carboxylic acid
4-cyclopropyl-1,3-thiazole-5-carboxylic acid (PubChem CID 71695492) has the molecular formula C7H7NO2S
and a molecular weight of 169.21 g/mol. Its IUPAC name is 4-cyclopropyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-cyclopropyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 71695492 |
| Molecular Formula | C7H7NO2S |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | 4-cyclopropyl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1scnc1C1CC1 |
| InChI | InChI=1S/C7H7NO2S/c9-7(10)6-5(4-1-2-4)8-3-11-6/h3-4H,1-2H2,(H,9,10) |
| InChIKey | WKJZCJVCVKTKBR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopropyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-cyclopropyl-1,3-thiazole-5-carboxylic acid (CID 71695492) is 4-cyclopropyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-cyclopropyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-cyclopropyl-1,3-thiazole-5-carboxylic acid is O=C(O)c1scnc1C1CC1.
What is the InChIKey of 4-cyclopropyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is WKJZCJVCVKTKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2S/c9-7(10)6-5(4-1-2-4)8-3-11-6/h3-4H,1-2H2,(H,9,10).
What are the key properties of 4-cyclopropyl-1,3-thiazole-5-carboxylic acid?
4-cyclopropyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 169.21 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 71695492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).