C24H24O5 — CID 71695593
3-[(3-oxo-1,2-dihydroinden-5-yl)oxy]propyl 3-(3-oxo-1,2-dihydroinden-5-yl)propanoate (PubChem CID 71695593) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is 3-[(3-oxo-1,2-dihydroinden-5-yl)oxy]propyl 3-(3-oxo-1,2-dihydroinden-5-yl)propanoate.
| Compound Name | 3-[(3-oxo-1,2-dihydroinden-5-yl)oxy]propyl 3-(3-oxo-1,2-dihydroinden-5-yl)propanoate |
|---|---|
| PubChem CID | 71695593 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 3-[(3-oxo-1,2-dihydroinden-5-yl)oxy]propyl 3-(3-oxo-1,2-dihydroinden-5-yl)propanoate |
| SMILES | O=C(CCc1ccc2c(c1)C(=O)CC2)OCCCOc1ccc2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C24H24O5/c25-22-9-6-17-4-2-16(14-20(17)22)3-11-24(27)29-13-1-12-28-19-8-5-18-7-10-23(26)21(18)15-19/h2,4-5,8,14-15H,1,3,6-7,9-13H2 |
| InChIKey | MTNUKPYBMCEOIV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|