C7H12F6O2Si — CID 71695730
1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy(trimethyl)silane (PubChem CID 71695730) has the molecular formula C7H12F6O2Si and a molecular weight of 270.25 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy(trimethyl)silane.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy(trimethyl)silane |
|---|---|
| PubChem CID | 71695730 |
| Molecular Formula | C7H12F6O2Si |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy(trimethyl)silane |
| SMILES | C[Si](C)(C)OCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H12F6O2Si/c1-16(2,3)15-4-14-5(6(8,9)10)7(11,12)13/h5H,4H2,1-3H3 |
| InChIKey | IRXYEWHVMCHLHP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|