C23H26N4O4 — CID 71695753
6-N-[1-(1,2-oxazol-3-yl)ethyl]-8-N-[(1R)-1-phenylpropyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide (PubChem CID 71695753) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 6-N-[1-(1,2-oxazol-3-yl)ethyl]-8-N-[(1R)-1-phenylpropyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide.
| Compound Name | 6-N-[1-(1,2-oxazol-3-yl)ethyl]-8-N-[(1R)-1-phenylpropyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide |
|---|---|
| PubChem CID | 71695753 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 6-N-[1-(1,2-oxazol-3-yl)ethyl]-8-N-[(1R)-1-phenylpropyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide |
| SMILES | CC[C@@H](NC(=O)c1cc(C(=O)NC(C)c2ccon2)n2c1COCC2)c1ccccc1 |
| InChI | InChI=1S/C23H26N4O4/c1-3-18(16-7-5-4-6-8-16)25-22(28)17-13-20(27-10-12-30-14-21(17)27)23(29)24-15(2)19-9-11-31-26-19/h4-9,11,13,15,18H,3,10,12,14H2,1-2H3,(H,24,29)(H,25,28)/t15?,18-/m1/s1 |
| InChIKey | UWVIZGIZROMNFD-KPMSDPLLSA-N |
| XLogP | 3.38 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |