About 3-(4-methylphenyl)-1,5,3-dithiazepane
3-(4-methylphenyl)-1,5,3-dithiazepane (PubChem CID 71695757) has the molecular formula C11H15NS2
and a molecular weight of 225.38 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1,5,3-dithiazepane.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)-1,5,3-dithiazepane |
| PubChem CID | 71695757 |
| Molecular Formula | C11H15NS2 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-(4-methylphenyl)-1,5,3-dithiazepane |
| SMILES | Cc1ccc(N2CSCCSC2)cc1 |
| InChI | InChI=1S/C11H15NS2/c1-10-2-4-11(5-3-10)12-8-13-6-7-14-9-12/h2-5H,6-9H2,1H3 |
| InChIKey | NNSMAFRMNSQLDV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methylphenyl)-1,5,3-dithiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)-1,5,3-dithiazepane?
The IUPAC name of 3-(4-methylphenyl)-1,5,3-dithiazepane (CID 71695757) is 3-(4-methylphenyl)-1,5,3-dithiazepane.
What is the SMILES notation for 3-(4-methylphenyl)-1,5,3-dithiazepane?
The canonical SMILES for 3-(4-methylphenyl)-1,5,3-dithiazepane is Cc1ccc(N2CSCCSC2)cc1.
What is the InChIKey of 3-(4-methylphenyl)-1,5,3-dithiazepane?
The InChIKey is NNSMAFRMNSQLDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS2/c1-10-2-4-11(5-3-10)12-8-13-6-7-14-9-12/h2-5H,6-9H2,1H3.
What are the key properties of 3-(4-methylphenyl)-1,5,3-dithiazepane?
3-(4-methylphenyl)-1,5,3-dithiazepane has a molecular weight of 225.38 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)-1,5,3-dithiazepane is sourced from PubChem (CID 71695757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).