C25H25F4N5O3 — CID 71695936
6-N-[(1R)-1-(4-fluorophenyl)ethyl]-8-N-[(1R)-1-[5-(trifluoromethyl)pyrimidin-2-yl]propyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide (PubChem CID 71695936) has the molecular formula C25H25F4N5O3 and a molecular weight of 519.50 g/mol. Its IUPAC name is 6-N-[(1R)-1-(4-fluorophenyl)ethyl]-8-N-[(1R)-1-[5-(trifluoromethyl)pyrimidin-2-yl]propyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide.
| Compound Name | 6-N-[(1R)-1-(4-fluorophenyl)ethyl]-8-N-[(1R)-1-[5-(trifluoromethyl)pyrimidin-2-yl]propyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide |
|---|---|
| PubChem CID | 71695936 |
| Molecular Formula | C25H25F4N5O3 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 6-N-[(1R)-1-(4-fluorophenyl)ethyl]-8-N-[(1R)-1-[5-(trifluoromethyl)pyrimidin-2-yl]propyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide |
| SMILES | CC[C@@H](NC(=O)c1cc(C(=O)N[C@H](C)c2ccc(F)cc2)n2c1COCC2)c1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C25H25F4N5O3/c1-3-19(22-30-11-16(12-31-22)25(27,28)29)33-23(35)18-10-20(34-8-9-37-13-21(18)34)24(36)32-14(2)15-4-6-17(26)7-5-15/h4-7,10-12,14,19H,3,8-9,13H2,1-2H3,(H,32,36)(H,33,35)/t14-,19-/m1/s1 |
| InChIKey | NRBJSUXHTSKWKR-AUUYWEPGSA-N |
| XLogP | 4.34 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |