C28H24F3N3O3 — CID 71695988
2-[4-[4-[2-[(3,4,5-trifluorophenyl)carbamoyl]imidazo[1,2-a]pyridin-6-yl]phenyl]cyclohexyl]acetic acid (PubChem CID 71695988) has the molecular formula C28H24F3N3O3 and a molecular weight of 507.51 g/mol. Its IUPAC name is 2-[4-[4-[2-[(3,4,5-trifluorophenyl)carbamoyl]imidazo[1,2-a]pyridin-6-yl]phenyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[2-[(3,4,5-trifluorophenyl)carbamoyl]imidazo[1,2-a]pyridin-6-yl]phenyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 71695988 |
| Molecular Formula | C28H24F3N3O3 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 2-[4-[4-[2-[(3,4,5-trifluorophenyl)carbamoyl]imidazo[1,2-a]pyridin-6-yl]phenyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1CCC(c2ccc(-c3ccc4nc(C(=O)Nc5cc(F)c(F)c(F)c5)cn4c3)cc2)CC1 |
| InChI | InChI=1S/C28H24F3N3O3/c29-22-12-21(13-23(30)27(22)31)32-28(37)24-15-34-14-20(9-10-25(34)33-24)19-7-5-18(6-8-19)17-3-1-16(2-4-17)11-26(35)36/h5-10,12-17H,1-4,11H2,(H,32,37)(H,35,36) |
| InChIKey | PPERHPKBXUFEOR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|