C14H20N6O — CID 71696039
3-[2-amino-4-(butylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-oxopropanenitrile (PubChem CID 71696039) has the molecular formula C14H20N6O and a molecular weight of 288.36 g/mol. Its IUPAC name is 3-[2-amino-4-(butylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-oxopropanenitrile.
| Compound Name | 3-[2-amino-4-(butylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 71696039 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 3-[2-amino-4-(butylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-oxopropanenitrile |
| SMILES | CCCCNc1nc(N)nc2c1CN(C(=O)CC#N)CC2 |
| InChI | InChI=1S/C14H20N6O/c1-2-3-7-17-13-10-9-20(12(21)4-6-15)8-5-11(10)18-14(16)19-13/h2-5,7-9H2,1H3,(H3,16,17,18,19) |
| InChIKey | HMZFKVJISPCFRP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|