C14H20F3N5O — CID 71696043
1-[2-amino-4-(butylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3,3,3-trifluoropropan-1-one (PubChem CID 71696043) has the molecular formula C14H20F3N5O and a molecular weight of 331.34 g/mol. Its IUPAC name is 1-[2-amino-4-(butylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-[2-amino-4-(butylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 71696043 |
| Molecular Formula | C14H20F3N5O |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-[2-amino-4-(butylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3,3,3-trifluoropropan-1-one |
| SMILES | CCCCNc1nc(N)nc2c1CN(C(=O)CC(F)(F)F)CC2 |
| InChI | InChI=1S/C14H20F3N5O/c1-2-3-5-19-12-9-8-22(11(23)7-14(15,16)17)6-4-10(9)20-13(18)21-12/h2-8H2,1H3,(H3,18,19,20,21) |
| InChIKey | KVPCURUYUCJBRH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|