About 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid
2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid (PubChem CID 71696274) has the molecular formula C23H28N2O3
and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid |
| PubChem CID | 71696274 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid |
| SMILES | Cc1cccc2[nH]cc(C(C)CC(=O)N3C4CC5CC3CC(C(=O)O)(C5)C4)c12 |
| InChI | InChI=1S/C23H28N2O3/c1-13-4-3-5-19-21(13)18(12-24-19)14(2)6-20(26)25-16-7-15-8-17(25)11-23(9-15,10-16)22(27)28/h3-5,12,14-17,24H,6-11H2,1-2H3,(H,27,28) |
| InChIKey | SSVGHQQWOZGYGG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid?
The IUPAC name of 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid (CID 71696274) is 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid.
What is the SMILES notation for 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid?
The canonical SMILES for 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid is Cc1cccc2[nH]cc(C(C)CC(=O)N3C4CC5CC3CC(C(=O)O)(C5)C4)c12.
What is the InChIKey of 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid?
The InChIKey is SSVGHQQWOZGYGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O3/c1-13-4-3-5-19-21(13)18(12-24-19)14(2)6-20(26)25-16-7-15-8-17(25)11-23(9-15,10-16)22(27)28/h3-5,12,14-17,24H,6-11H2,1-2H3,(H,27,28).
What are the key properties of 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid?
2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid has a molecular weight of 380.49 g/mol, XLogP of 4.21, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-methyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carboxylic acid is sourced from PubChem (CID 71696274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).