C44H54BF2N3O2 — CID 71696907
4-(2,2-difluoro-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl)-N,N-bis(4-hexoxyphenyl)aniline (PubChem CID 71696907) has the molecular formula C44H54BF2N3O2 and a molecular weight of 705.74 g/mol. Its IUPAC name is 4-(2,2-difluoro-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl)-N,N-bis(4-hexoxyphenyl)aniline.
| Compound Name | 4-(2,2-difluoro-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl)-N,N-bis(4-hexoxyphenyl)aniline |
|---|---|
| PubChem CID | 71696907 |
| Molecular Formula | C44H54BF2N3O2 |
| Molecular Weight | 705.74 g/mol |
| Exact Mass | 705.43 |
| IUPAC Name | 4-(2,2-difluoro-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl)-N,N-bis(4-hexoxyphenyl)aniline |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(C3=C(C)C4=C(C)c5c(C)cc(C)n5[B-](F)(F)[N+]4=C3C)cc2)cc1 |
| InChI | InChI=1S/C44H54BF2N3O2/c1-8-10-12-14-28-51-40-24-20-38(21-25-40)48(39-22-26-41(27-23-39)52-29-15-13-11-9-2)37-18-16-36(17-19-37)42-33(5)44-34(6)43-31(3)30-32(4)49(43)45(46,47)50(44)35(42)7/h16-27,30H,8-15,28-29H2,1-7H3 |
| InChIKey | JEFZTZBBRFVFOA-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 29.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.74 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|