C75H82N4O4Zn — CID 71697152
zinc 4-[2-[10,15,20-tris[2,4,6-tri(propan-2-yl)phenyl]porphyrin-22,24-diid-5-yl]ethynyl]phthalic acid (PubChem CID 71697152) has the molecular formula C75H82N4O4Zn and a molecular weight of 1168.89 g/mol. Its IUPAC name is zinc 4-[2-[10,15,20-tris[2,4,6-tri(propan-2-yl)phenyl]porphyrin-22,24-diid-5-yl]ethynyl]phthalic acid.
| Compound Name | zinc 4-[2-[10,15,20-tris[2,4,6-tri(propan-2-yl)phenyl]porphyrin-22,24-diid-5-yl]ethynyl]phthalic acid |
|---|---|
| PubChem CID | 71697152 |
| Molecular Formula | C75H82N4O4Zn |
| Molecular Weight | 1168.89 g/mol |
| Exact Mass | 1166.56 |
| IUPAC Name | zinc 4-[2-[10,15,20-tris[2,4,6-tri(propan-2-yl)phenyl]porphyrin-22,24-diid-5-yl]ethynyl]phthalic acid |
| SMILES | CC(C)c1cc(C(C)C)c(-c2c3nc(c(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)c4ccc([n-]4)c(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)c4nc(c(C#Cc5ccc(C(=O)O)c(C(=O)O)c5)c5ccc2[n-]5)C=C4)C=C3)c(C(C)C)c1.[Zn+2] |
| InChI | InChI=1S/C75H84N4O4.Zn/c1-38(2)48-32-53(41(7)8)68(54(33-48)42(9)10)71-62-25-23-60(76-62)52(22-20-47-19-21-51(74(80)81)59(31-47)75(82)83)61-24-26-63(77-61)72(69-55(43(11)12)34-49(39(3)4)35-56(69)44(13)14)65-28-30-67(79-65)73(66-29-27-64(71)78-66)70-57(45(15)16)36-50(40(5)6)37-58(70)46(17)18;/h19,21,23-46H,1-18H3,(H4,76,77,78,79,80,81,82,83);/q;+2/p-2/b60-52-,61-52-,71-62+,71-64+,72-63+,72-65+,73-66+,73-67+; |
| InChIKey | RGHAFLUIOAYRCN-FGNDGGLUSA-L |
| XLogP | 19.82 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1168.89 |
| LogP ≤ 5 | 19.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|