C26H28FO6PS — CID 71697233
[(Z,3R,4R)-4-(benzenesulfonyl)-4-fluoro-1,3-diphenylbut-1-enyl] diethyl phosphate (PubChem CID 71697233) has the molecular formula C26H28FO6PS and a molecular weight of 518.54 g/mol. Its IUPAC name is [(Z,3R,4R)-4-(benzenesulfonyl)-4-fluoro-1,3-diphenylbut-1-enyl] diethyl phosphate.
| Compound Name | [(Z,3R,4R)-4-(benzenesulfonyl)-4-fluoro-1,3-diphenylbut-1-enyl] diethyl phosphate |
|---|---|
| PubChem CID | 71697233 |
| Molecular Formula | C26H28FO6PS |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | [(Z,3R,4R)-4-(benzenesulfonyl)-4-fluoro-1,3-diphenylbut-1-enyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C\[C@H](c1ccccc1)[C@H](F)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28FO6PS/c1-3-31-34(28,32-4-2)33-25(22-16-10-6-11-17-22)20-24(21-14-8-5-9-15-21)26(27)35(29,30)23-18-12-7-13-19-23/h5-20,24,26H,3-4H2,1-2H3/b25-20-/t24-,26-/m1/s1 |
| InChIKey | SYVLTNNWBUKUDK-JEAMNVHWSA-N |
| XLogP | 6.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|