C42H41FN4O5 — CID 71697782
N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 71697782) has the molecular formula C42H41FN4O5 and a molecular weight of 700.81 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 71697782 |
| Molecular Formula | C42H41FN4O5 |
| Molecular Weight | 700.81 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccc(Oc4ccnc5cc(OCCCN6CCC(C)CC6)c(OC)cc45)c(F)c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C42H41FN4O5/c1-27-16-20-47(21-17-27)19-6-22-51-41-26-37-33(25-40(41)50-3)38(15-18-44-37)52-39-14-11-29(23-34(39)43)45-42(48)32-24-36(28-9-12-30(49-2)13-10-28)46-35-8-5-4-7-31(32)35/h4-5,7-15,18,23-27H,6,16-17,19-22H2,1-3H3,(H,45,48) |
| InChIKey | PUOTWPJGGKRXRB-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.81 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|