C12H20O5 — CID 71697895
[(3aS,6R,6aR)-2,2-dimethyl-4-methylidene-6-propan-2-yloxy-6,6a-dihydrofuro[3,4-d][1,3]dioxol-3a-yl]methanol (PubChem CID 71697895) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(3aS,6R,6aR)-2,2-dimethyl-4-methylidene-6-propan-2-yloxy-6,6a-dihydrofuro[3,4-d][1,3]dioxol-3a-yl]methanol.
| Compound Name | [(3aS,6R,6aR)-2,2-dimethyl-4-methylidene-6-propan-2-yloxy-6,6a-dihydrofuro[3,4-d][1,3]dioxol-3a-yl]methanol |
|---|---|
| PubChem CID | 71697895 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [(3aS,6R,6aR)-2,2-dimethyl-4-methylidene-6-propan-2-yloxy-6,6a-dihydrofuro[3,4-d][1,3]dioxol-3a-yl]methanol |
| SMILES | C=C1O[C@@H](OC(C)C)[C@@H]2OC(C)(C)O[C@]12CO |
| InChI | InChI=1S/C12H20O5/c1-7(2)14-10-9-12(6-13,8(3)15-10)17-11(4,5)16-9/h7,9-10,13H,3,6H2,1-2,4-5H3/t9-,10+,12+/m0/s1 |
| InChIKey | RCIDMVLUOCFMLX-HOSYDEDBSA-N |
| XLogP | 1.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |