C30H56O5Si2 — CID 71697898
methyl (1S,2S,6R,7S,8R,9S,14R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,14-dimethyl-4-oxotricyclo[5.4.3.01,8]tetradecane-7-carboxylate (PubChem CID 71697898) has the molecular formula C30H56O5Si2 and a molecular weight of 552.95 g/mol. Its IUPAC name is methyl (1S,2S,6R,7S,8R,9S,14R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,14-dimethyl-4-oxotricyclo[5.4.3.01,8]tetradecane-7-carboxylate.
| Compound Name | methyl (1S,2S,6R,7S,8R,9S,14R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,14-dimethyl-4-oxotricyclo[5.4.3.01,8]tetradecane-7-carboxylate |
|---|---|
| PubChem CID | 71697898 |
| Molecular Formula | C30H56O5Si2 |
| Molecular Weight | 552.95 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | methyl (1S,2S,6R,7S,8R,9S,14R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,14-dimethyl-4-oxotricyclo[5.4.3.01,8]tetradecane-7-carboxylate |
| SMILES | COC(=O)[C@@]12[C@H](C)CC[C@]3(CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]31)[C@@H](C)CC(=O)C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H56O5Si2/c1-20-14-16-29-17-15-23(34-36(10,11)27(3,4)5)25(29)30(20,26(32)33-9)24(19-22(31)18-21(29)2)35-37(12,13)28(6,7)8/h20-21,23-25H,14-19H2,1-13H3/t20-,21+,23+,24-,25-,29+,30-/m1/s1 |
| InChIKey | RGTXOIUAHHRJRD-XYUJEBTASA-N |
| XLogP | 7.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.95 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|