C26H18N2O5 — CID 71698004
methyl 7-benzoyl-2,4-dioxo-3,6-diphenyl-1,3-diazabicyclo[3.2.0]hept-6-ene-5-carboxylate (PubChem CID 71698004) has the molecular formula C26H18N2O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is methyl 7-benzoyl-2,4-dioxo-3,6-diphenyl-1,3-diazabicyclo[3.2.0]hept-6-ene-5-carboxylate.
| Compound Name | methyl 7-benzoyl-2,4-dioxo-3,6-diphenyl-1,3-diazabicyclo[3.2.0]hept-6-ene-5-carboxylate |
|---|---|
| PubChem CID | 71698004 |
| Molecular Formula | C26H18N2O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | methyl 7-benzoyl-2,4-dioxo-3,6-diphenyl-1,3-diazabicyclo[3.2.0]hept-6-ene-5-carboxylate |
| SMILES | COC(=O)C12C(=O)N(c3ccccc3)C(=O)N1C(C(=O)c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C26H18N2O5/c1-33-24(31)26-20(17-11-5-2-6-12-17)21(22(29)18-13-7-3-8-14-18)28(26)25(32)27(23(26)30)19-15-9-4-10-16-19/h2-16H,1H3 |
| InChIKey | RLAIZLFEZAELMF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|