C10H12N6OS3 — CID 71698280
[[2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetyl]amino]carbamodithioic acid (PubChem CID 71698280) has the molecular formula C10H12N6OS3 and a molecular weight of 328.45 g/mol. Its IUPAC name is [[2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetyl]amino]carbamodithioic acid.
| Compound Name | [[2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetyl]amino]carbamodithioic acid |
|---|---|
| PubChem CID | 71698280 |
| Molecular Formula | C10H12N6OS3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | [[2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetyl]amino]carbamodithioic acid |
| SMILES | Cc1cc(C)n2nc(SCC(=O)NNC(=S)S)nc2n1 |
| InChI | InChI=1S/C10H12N6OS3/c1-5-3-6(2)16-8(11-5)12-9(15-16)20-4-7(17)13-14-10(18)19/h3H,4H2,1-2H3,(H,13,17)(H2,14,18,19) |
| InChIKey | VONYBBBJWGKKBS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|