C15H17N5O3 — CID 71698413
N-[(E)-(4-ethylphenyl)methylideneamino]-2-(2-methyl-5-nitroimidazol-1-yl)acetamide (PubChem CID 71698413) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-[(E)-(4-ethylphenyl)methylideneamino]-2-(2-methyl-5-nitroimidazol-1-yl)acetamide.
| Compound Name | N-[(E)-(4-ethylphenyl)methylideneamino]-2-(2-methyl-5-nitroimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 71698413 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-[(E)-(4-ethylphenyl)methylideneamino]-2-(2-methyl-5-nitroimidazol-1-yl)acetamide |
| SMILES | CCc1ccc(/C=N/NC(=O)Cn2c([N+](=O)[O-])cnc2C)cc1 |
| InChI | InChI=1S/C15H17N5O3/c1-3-12-4-6-13(7-5-12)8-17-18-14(21)10-19-11(2)16-9-15(19)20(22)23/h4-9H,3,10H2,1-2H3,(H,18,21)/b17-8+ |
| InChIKey | FGVZZVBFQWAMAU-CAOOACKPSA-N |
| XLogP | 1.81 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|