C19H25FN2O6S — CID 71698800
1-(4-fluorobutyl)-5-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione (PubChem CID 71698800) has the molecular formula C19H25FN2O6S and a molecular weight of 428.48 g/mol. Its IUPAC name is 1-(4-fluorobutyl)-5-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione.
| Compound Name | 1-(4-fluorobutyl)-5-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 71698800 |
| Molecular Formula | C19H25FN2O6S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1-(4-fluorobutyl)-5-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
| SMILES | COC[C@@H]1C[C@H](OC)CN1S(=O)(=O)c1ccc2c(c1)C(=O)C(=O)N2CCCCF |
| InChI | InChI=1S/C19H25FN2O6S/c1-27-12-13-9-14(28-2)11-22(13)29(25,26)15-5-6-17-16(10-15)18(23)19(24)21(17)8-4-3-7-20/h5-6,10,13-14H,3-4,7-9,11-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | VYMYMLZCAIOYEX-KBPBESRZSA-N |
| XLogP | 1.39 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|