C25H18FN7O — CID 71699876
N-[(E)-1-[3-[(7-fluoroquinolin-6-yl)methyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]-1,3-benzoxazol-2-amine (PubChem CID 71699876) has the molecular formula C25H18FN7O and a molecular weight of 451.47 g/mol. Its IUPAC name is N-[(E)-1-[3-[(7-fluoroquinolin-6-yl)methyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(E)-1-[3-[(7-fluoroquinolin-6-yl)methyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 71699876 |
| Molecular Formula | C25H18FN7O |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | N-[(E)-1-[3-[(7-fluoroquinolin-6-yl)methyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]-1,3-benzoxazol-2-amine |
| SMILES | C/C(=N\Nc1nc2ccccc2o1)c1ccc2ncc(Cc3cc4cccnc4cc3F)n2n1 |
| InChI | InChI=1S/C25H18FN7O/c1-15(30-31-25-29-21-6-2-3-7-23(21)34-25)20-8-9-24-28-14-18(33(24)32-20)12-17-11-16-5-4-10-27-22(16)13-19(17)26/h2-11,13-14H,12H2,1H3,(H,29,31)/b30-15+ |
| InChIKey | HLHJFGYWEPHJFZ-FJEPWZHXSA-N |
| XLogP | 4.98 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|