C20H19N5O2 — CID 71700569
N-[5-[2-(1H-indol-3-yl)ethyl]-1H-1,2,4-triazol-3-yl]-2-methoxybenzamide (PubChem CID 71700569) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-[5-[2-(1H-indol-3-yl)ethyl]-1H-1,2,4-triazol-3-yl]-2-methoxybenzamide.
| Compound Name | N-[5-[2-(1H-indol-3-yl)ethyl]-1H-1,2,4-triazol-3-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 71700569 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[5-[2-(1H-indol-3-yl)ethyl]-1H-1,2,4-triazol-3-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1n[nH]c(CCc2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C20H19N5O2/c1-27-17-9-5-3-7-15(17)19(26)23-20-22-18(24-25-20)11-10-13-12-21-16-8-4-2-6-14(13)16/h2-9,12,21H,10-11H2,1H3,(H2,22,23,24,25,26) |
| InChIKey | WSPVBKSLVUACDP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |