C18H15N3O3 — CID 71701058
3-(3,4-dimethoxyphenyl)-7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine (PubChem CID 71701058) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 71701058 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine |
| SMILES | COc1ccc(-c2cnn3c(-c4ccco4)ccnc23)cc1OC |
| InChI | InChI=1S/C18H15N3O3/c1-22-16-6-5-12(10-17(16)23-2)13-11-20-21-14(7-8-19-18(13)21)15-4-3-9-24-15/h3-11H,1-2H3 |
| InChIKey | LYVKMKCMUOGOQY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |