C20H21N3O3 — CID 71701249
14-cyclopentyl-10-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione (PubChem CID 71701249) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 14-cyclopentyl-10-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione.
| Compound Name | 14-cyclopentyl-10-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione |
|---|---|
| PubChem CID | 71701249 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 14-cyclopentyl-10-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione |
| SMILES | CC(C)c1c2oc3cc(=O)ccc3c2[nH]c2c1c(=O)[nH]n2C1CCCC1 |
| InChI | InChI=1S/C20H21N3O3/c1-10(2)15-16-19(23(22-20(16)25)11-5-3-4-6-11)21-17-13-8-7-12(24)9-14(13)26-18(15)17/h7-11,21H,3-6H2,1-2H3,(H,22,25) |
| InChIKey | OFHLVOFKQURJHK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |