C14H14N2O4 — CID 71701636
methyl 3-[(1-oxo-2H-isoquinoline-4-carbonyl)amino]propanoate (PubChem CID 71701636) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is methyl 3-[(1-oxo-2H-isoquinoline-4-carbonyl)amino]propanoate.
| Compound Name | methyl 3-[(1-oxo-2H-isoquinoline-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 71701636 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | methyl 3-[(1-oxo-2H-isoquinoline-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1c[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C14H14N2O4/c1-20-12(17)6-7-15-14(19)11-8-16-13(18)10-5-3-2-4-9(10)11/h2-5,8H,6-7H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | TYBXWOMKNXZKHP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |