About 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one
3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one (PubChem CID 71701660) has the molecular formula C16H25N3O4
and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one.
Molecular Properties
| Compound Name | 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one |
| PubChem CID | 71701660 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one |
| SMILES | Cn1c(CN2CCOCC2)cc(=O)c(O)c1CN1CCOCC1 |
| InChI | InChI=1S/C16H25N3O4/c1-17-13(11-18-2-6-22-7-3-18)10-15(20)16(21)14(17)12-19-4-8-23-9-5-19/h10,21H,2-9,11-12H2,1H3 |
| InChIKey | KSTZQHUTYXSJLN-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one?
The IUPAC name of 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one (CID 71701660) is 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one.
What is the SMILES notation for 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one?
The canonical SMILES for 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one is Cn1c(CN2CCOCC2)cc(=O)c(O)c1CN1CCOCC1.
What is the InChIKey of 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one?
The InChIKey is KSTZQHUTYXSJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O4/c1-17-13(11-18-2-6-22-7-3-18)10-15(20)16(21)14(17)12-19-4-8-23-9-5-19/h10,21H,2-9,11-12H2,1H3.
What are the key properties of 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one?
3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one has a molecular weight of 323.39 g/mol, XLogP of -0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1-methyl-2,6-bis(morpholin-4-ylmethyl)pyridin-4-one is sourced from PubChem (CID 71701660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).