C25H21N3O5 — CID 71702234
4-(14-cyclopentyl-6-methyl-5,12-dioxo-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaen-10-yl)benzoic acid (PubChem CID 71702234) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 4-(14-cyclopentyl-6-methyl-5,12-dioxo-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaen-10-yl)benzoic acid.
| Compound Name | 4-(14-cyclopentyl-6-methyl-5,12-dioxo-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaen-10-yl)benzoic acid |
|---|---|
| PubChem CID | 71702234 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-(14-cyclopentyl-6-methyl-5,12-dioxo-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaen-10-yl)benzoic acid |
| SMILES | Cc1c(=O)ccc2c1oc1c(-c3ccc(C(=O)O)cc3)c3c(=O)[nH]n(C4CCCC4)c3[nH]c12 |
| InChI | InChI=1S/C25H21N3O5/c1-12-17(29)11-10-16-20-22(33-21(12)16)18(13-6-8-14(9-7-13)25(31)32)19-23(26-20)28(27-24(19)30)15-4-2-3-5-15/h6-11,15,26H,2-5H2,1H3,(H,27,30)(H,31,32) |
| InChIKey | VYXUKCYNGIHGBM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |