C20H15N3O4 — CID 71703146
2-methoxy-N-(6-oxo-5H-pyrido[2,3-b][1,4]benzoxazepin-8-yl)benzamide (PubChem CID 71703146) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-methoxy-N-(6-oxo-5H-pyrido[2,3-b][1,4]benzoxazepin-8-yl)benzamide.
| Compound Name | 2-methoxy-N-(6-oxo-5H-pyrido[2,3-b][1,4]benzoxazepin-8-yl)benzamide |
|---|---|
| PubChem CID | 71703146 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-methoxy-N-(6-oxo-5H-pyrido[2,3-b][1,4]benzoxazepin-8-yl)benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc2c(c1)C(=O)Nc1cccnc1O2 |
| InChI | InChI=1S/C20H15N3O4/c1-26-16-7-3-2-5-13(16)18(24)22-12-8-9-17-14(11-12)19(25)23-15-6-4-10-21-20(15)27-17/h2-11H,1H3,(H,22,24)(H,23,25) |
| InChIKey | ZVULOLBQORXYOQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |