C20H21N3O4 — CID 71703847
14-cyclooctyl-6-hydroxy-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione (PubChem CID 71703847) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 14-cyclooctyl-6-hydroxy-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione.
| Compound Name | 14-cyclooctyl-6-hydroxy-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione |
|---|---|
| PubChem CID | 71703847 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 14-cyclooctyl-6-hydroxy-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione |
| SMILES | O=c1ccc2c(oc3cc4c(=O)[nH]n(C5CCCCCCC5)c4[nH]c32)c1O |
| InChI | InChI=1S/C20H21N3O4/c24-14-9-8-12-16-15(27-18(12)17(14)25)10-13-19(21-16)23(22-20(13)26)11-6-4-2-1-3-5-7-11/h8-11,21,25H,1-7H2,(H,22,26) |
| InChIKey | HIULFGFSMAMCDI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |