About 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide
2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide (PubChem CID 71703973) has the molecular formula C17H28N4O2S
and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide.
Molecular Properties
| Compound Name | 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide |
| PubChem CID | 71703973 |
| Molecular Formula | C17H28N4O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide |
| SMILES | CSCCC(Nc1nc(C)cc(C)n1)C(=O)NCC1CCOCC1 |
| InChI | InChI=1S/C17H28N4O2S/c1-12-10-13(2)20-17(19-12)21-15(6-9-24-3)16(22)18-11-14-4-7-23-8-5-14/h10,14-15H,4-9,11H2,1-3H3,(H,18,22)(H,19,20,21) |
| InChIKey | MSYGYKJKDZKKGV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide?
The IUPAC name of 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide (CID 71703973) is 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide.
What is the SMILES notation for 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide?
The canonical SMILES for 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide is CSCCC(Nc1nc(C)cc(C)n1)C(=O)NCC1CCOCC1.
What is the InChIKey of 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide?
The InChIKey is MSYGYKJKDZKKGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O2S/c1-12-10-13(2)20-17(19-12)21-15(6-9-24-3)16(22)18-11-14-4-7-23-8-5-14/h10,14-15H,4-9,11H2,1-3H3,(H,18,22)(H,19,20,21).
What are the key properties of 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide?
2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide has a molecular weight of 352.50 g/mol, XLogP of 2.17, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanyl-N-(oxan-4-ylmethyl)butanamide is sourced from PubChem (CID 71703973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).