C19H16Cl3NO3 — CID 7170414
[(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate (PubChem CID 7170414) has the molecular formula C19H16Cl3NO3 and a molecular weight of 412.70 g/mol. Its IUPAC name is [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate.
| Compound Name | [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 7170414 |
| Molecular Formula | C19H16Cl3NO3 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,3,6-trichlorobenzoate |
| SMILES | C[C@H](OC(=O)c1c(Cl)ccc(Cl)c1Cl)C(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H16Cl3NO3/c1-11(26-19(25)16-14(20)6-7-15(21)17(16)22)18(24)23-9-8-12-4-2-3-5-13(12)10-23/h2-7,11H,8-10H2,1H3/t11-/m0/s1 |
| InChIKey | VRTUWUXIKSNNSR-NSHDSACASA-N |
| XLogP | 4.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|