C21H24ClN3O — CID 71704354
2-(2-chloroquinolin-3-yl)-5,7-diethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 71704354) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is 2-(2-chloroquinolin-3-yl)-5,7-diethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 2-(2-chloroquinolin-3-yl)-5,7-diethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 71704354 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-(2-chloroquinolin-3-yl)-5,7-diethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CCC12CN3CC(CC)(CN(C1)C3c1cc3ccccc3nc1Cl)C2=O |
| InChI | InChI=1S/C21H24ClN3O/c1-3-20-10-24-12-21(4-2,19(20)26)13-25(11-20)18(24)15-9-14-7-5-6-8-16(14)23-17(15)22/h5-9,18H,3-4,10-13H2,1-2H3 |
| InChIKey | LMTRUCGGNYILJG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|