About 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide
3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide (PubChem CID 71704957) has the molecular formula C15H24N4O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide |
| PubChem CID | 71704957 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide |
| SMILES | Cc1cc(C)nc(NCCC(=O)NCC2CCOCC2)n1 |
| InChI | InChI=1S/C15H24N4O2/c1-11-9-12(2)19-15(18-11)16-6-3-14(20)17-10-13-4-7-21-8-5-13/h9,13H,3-8,10H2,1-2H3,(H,17,20)(H,16,18,19) |
| InChIKey | GLTCKBNGPFZYRQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide?
The IUPAC name of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide (CID 71704957) is 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide.
What is the SMILES notation for 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide?
The canonical SMILES for 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide is Cc1cc(C)nc(NCCC(=O)NCC2CCOCC2)n1.
What is the InChIKey of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide?
The InChIKey is GLTCKBNGPFZYRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O2/c1-11-9-12(2)19-15(18-11)16-6-3-14(20)17-10-13-4-7-21-8-5-13/h9,13H,3-8,10H2,1-2H3,(H,17,20)(H,16,18,19).
What are the key properties of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide?
3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide has a molecular weight of 292.38 g/mol, XLogP of 1.44, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(oxan-4-ylmethyl)propanamide is sourced from PubChem (CID 71704957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).