About (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one
(2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one (PubChem CID 71705478) has the molecular formula C21H18N2O3
and a molecular weight of 346.39 g/mol. Its IUPAC name is (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one.
Molecular Properties
| Compound Name | (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one |
| PubChem CID | 71705478 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)/C(=C\c1ccc(-n3cccn3)cc1)C2 |
| InChI | InChI=1S/C21H18N2O3/c1-25-19-12-15-11-16(21(24)18(15)13-20(19)26-2)10-14-4-6-17(7-5-14)23-9-3-8-22-23/h3-10,12-13H,11H2,1-2H3/b16-10- |
| InChIKey | ZBXYOJROOJSNCN-YBEGLDIGSA-N |
| XLogP | 3.71 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one?
The IUPAC name of (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one (CID 71705478) is (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one.
What is the SMILES notation for (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one?
The canonical SMILES for (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one is COc1cc2c(cc1OC)C(=O)/C(=C\c1ccc(-n3cccn3)cc1)C2.
What is the InChIKey of (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one?
The InChIKey is ZBXYOJROOJSNCN-YBEGLDIGSA-N. The full InChI is InChI=1S/C21H18N2O3/c1-25-19-12-15-11-16(21(24)18(15)13-20(19)26-2)10-14-4-6-17(7-5-14)23-9-3-8-22-23/h3-10,12-13H,11H2,1-2H3/b16-10-.
What are the key properties of (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one?
(2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one has a molecular weight of 346.39 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-5,6-dimethoxy-2-[(4-pyrazol-1-ylphenyl)methylidene]-3H-inden-1-one is sourced from PubChem (CID 71705478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).