C20H25N3O — CID 71706266
N-[(1-methylpyrrol-2-yl)methyl]-3-(1-propan-2-ylindol-3-yl)propanamide (PubChem CID 71706266) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]-3-(1-propan-2-ylindol-3-yl)propanamide.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]-3-(1-propan-2-ylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 71706266 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]-3-(1-propan-2-ylindol-3-yl)propanamide |
| SMILES | CC(C)n1cc(CCC(=O)NCc2cccn2C)c2ccccc21 |
| InChI | InChI=1S/C20H25N3O/c1-15(2)23-14-16(18-8-4-5-9-19(18)23)10-11-20(24)21-13-17-7-6-12-22(17)3/h4-9,12,14-15H,10-11,13H2,1-3H3,(H,21,24) |
| InChIKey | JQXDVQSPNCPNBF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |