C20H18F2N2O3 — CID 7170756
(5R)-3-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 7170756) has the molecular formula C20H18F2N2O3 and a molecular weight of 372.37 g/mol. Its IUPAC name is (5R)-3-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7170756 |
| Molecular Formula | C20H18F2N2O3 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (5R)-3-[2-(3,4-difluorophenyl)-2-oxoethyl]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | C[C@]1(CCc2ccccc2)NC(=O)N(CC(=O)c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C20H18F2N2O3/c1-20(10-9-13-5-3-2-4-6-13)18(26)24(19(27)23-20)12-17(25)14-7-8-15(21)16(22)11-14/h2-8,11H,9-10,12H2,1H3,(H,23,27)/t20-/m1/s1 |
| InChIKey | XPCSLQLCXVKKIF-HXUWFJFHSA-N |
| XLogP | 3.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|