C11H11N5OS — CID 71707625
5-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-methyl-1,2-oxazole (PubChem CID 71707625) has the molecular formula C11H11N5OS and a molecular weight of 261.31 g/mol. Its IUPAC name is 5-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-methyl-1,2-oxazole.
| Compound Name | 5-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 71707625 |
| Molecular Formula | C11H11N5OS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 5-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(-c2nn3c(C4CCC4)nnc3s2)on1 |
| InChI | InChI=1S/C11H11N5OS/c1-6-5-8(17-15-6)10-14-16-9(7-3-2-4-7)12-13-11(16)18-10/h5,7H,2-4H2,1H3 |
| InChIKey | GUMYRUXZSDAMRS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |