About methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate
methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate (PubChem CID 71707679) has the molecular formula C19H20F2O5S
and a molecular weight of 398.43 g/mol. Its IUPAC name is methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate |
| PubChem CID | 71707679 |
| Molecular Formula | C19H20F2O5S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate |
| SMILES | COC(=O)CC(c1oc(CSc2ccc(F)cc2F)cc(=O)c1O)C(C)C |
| InChI | InChI=1S/C19H20F2O5S/c1-10(2)13(8-17(23)25-3)19-18(24)15(22)7-12(26-19)9-27-16-5-4-11(20)6-14(16)21/h4-7,10,13,24H,8-9H2,1-3H3 |
| InChIKey | WGQBBGVUEIIGBY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate?
The IUPAC name of methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate (CID 71707679) is methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate.
What is the SMILES notation for methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate?
The canonical SMILES for methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate is COC(=O)CC(c1oc(CSc2ccc(F)cc2F)cc(=O)c1O)C(C)C.
What is the InChIKey of methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate?
The InChIKey is WGQBBGVUEIIGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2O5S/c1-10(2)13(8-17(23)25-3)19-18(24)15(22)7-12(26-19)9-27-16-5-4-11(20)6-14(16)21/h4-7,10,13,24H,8-9H2,1-3H3.
What are the key properties of methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate?
methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate has a molecular weight of 398.43 g/mol, XLogP of 4.22, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[6-[(2,4-difluorophenyl)sulfanylmethyl]-3-hydroxy-4-oxopyran-2-yl]-4-methylpentanoate is sourced from PubChem (CID 71707679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).